CAS 41016-29-9 appears in our catalog under these names: 3-Methyl-4-phenyl-2,5-furandione, 98%, 3-Methyl-4-phenylfuran-2,5-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-methyl-4-phenylfuran-2,5-dione (CAS 41016-29-9) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 3-methyl-4-phenylfuran-2,5-dione. InChIKey: FLXXGYZTCHZBPE-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 3-methyl-4-phenylfuran-2,5-dione |
| InChIKey | FLXXGYZTCHZBPE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)