Products 2437-16-3
CAS 2437-16-3 appears in our catalog under these names: 5-Hydroxy-1-naphthoic acid, 95%, 5-hydroxynaphthalene-1-carboxylic acid, 5-Hydroxy-1-naphthoic acid 98%, 5-hydroxy-1-naphthoic acid, 98%, 98%, 5-HYDROXYNAPHTHALENE-1-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 2,5g, 100mg.
5-hydroxynaphthalene-1-carboxylic acid (CAS 2437-16-3) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 5-hydroxynaphthalene-1-carboxylic acid. InChIKey: NYYMNZLORMNCKK-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 5-hydroxynaphthalene-1-carboxylic acid |
| InChIKey | NYYMNZLORMNCKK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2O)C(=C1)C(=O)O |
Computed by PubChem (NCBI)