CAS 20258-95-1 appears in our catalog under these names: 2,7-Dihydroxynaphthalene-1-carbaldehyde, 98%, 2,7-Dihydroxy-1-naphthaldehyde 98%, 2,7-Dihydroxy-1-naphthaldehyde, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2,7-dihydroxynaphthalene-1-carbaldehyde (CAS 20258-95-1) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 2,7-dihydroxynaphthalene-1-carbaldehyde. InChIKey: YLBPRJJZUISDEF-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2,7-dihydroxynaphthalene-1-carbaldehyde |
| InChIKey | YLBPRJJZUISDEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2C=O)O)O |
Computed by PubChem (NCBI)