CAS 923169-40-8 appears in our catalog under these names: 1-Benzoxepine-4-carboxylic acid, 95%, Benzo[b]oxepine-4-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
1-benzoxepine-4-carboxylic acid (CAS 923169-40-8) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 1-benzoxepine-4-carboxylic acid. InChIKey: YUXCMLDLILCXJV-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 1-benzoxepine-4-carboxylic acid |
| InChIKey | YUXCMLDLILCXJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=CO2)C(=O)O |
Computed by PubChem (NCBI)