CAS 858457-19-9 is the registry number for 1,8-Dihydroxy-2-naphthaldehyde, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,8-dihydroxynaphthalene-2-carbaldehyde (CAS 858457-19-9) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 1,8-dihydroxynaphthalene-2-carbaldehyde. InChIKey: QBXCVGGCXRBENM-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 1,8-dihydroxynaphthalene-2-carbaldehyde |
| InChIKey | QBXCVGGCXRBENM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=C(C=C2)C=O)O |
Computed by PubChem (NCBI)