Products 35461-99-5
CAS 35461-99-5 appears in our catalog under these names: 3-(Furan-2-yl)benzoic acid, 95%, 3-(Furan-2-yl)benzoic acid, 95-<97%, 3–(Furan–2–yl)benzoic acid, 3-(Fur-2-yl)benzoic acid, 3-(2-Furyl)benzoic acid, 97% . Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Biosynth, Thermo Scientific. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 50g, 100g, 200g.
3-(furan-2-yl)benzoic acid (CAS 35461-99-5) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 3-(furan-2-yl)benzoic acid. InChIKey: RQVVFGRDMHDHNI-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 3-(furan-2-yl)benzoic acid |
| InChIKey | RQVVFGRDMHDHNI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=CO2 |
Computed by PubChem (NCBI)