Products 1133-72-8
CAS 1133-72-8 appears in our catalog under these names: 2-Acetyl-1h-indene-1,3(2h)-dione, 95%, 2-Acetyl-1H-indene-1,3(2H)-dione, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-acetylindene-1,3-dione (CAS 1133-72-8) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 2-acetylindene-1,3-dione. InChIKey: SGLKFWMIZOJHCL-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-acetylindene-1,3-dione |
| InChIKey | SGLKFWMIZOJHCL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)
Synonyms:
2-Acetyl-1H-indene-1,3(2H)-dione, 1,3-Indandione, 2-acetyl-, 2-acetylindene-1,3-dione, 2-Acetyl-1,3-indandione, 1H-Indene-1,3(2H)-dione, 2-acetyl-, 2-Acetyl-1,3-indanedione, 2-acetyl-2,3-dihydro-1H-indene-1,3-dione, 2-acetylindane-1,3-dione, 3-07-00-04596 (Beilstein Handbook Reference), 1,3-Indanedione, 2-acetyl-