cas: 100157-53-7 — see every product listed under this CAS number, including other names
(2R,3R)-Methyl 2-(((benzyloxy)carbonyl)amino)-3-hydroxybutanoate 98% (CAS 100157-53-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A767649-250mg |
| cas | 100157-53-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A767649 |
Methyl (2R,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (CAS 100157-53-7) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: methyl (2R,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: OPZWAOJFQFYYIX-MWLCHTKSSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | methyl (2R,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | OPZWAOJFQFYYIX-MWLCHTKSSA-N |
| SMILES | C[C@H]([C@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)