cas: 100516-54-9 — see every product listed under this CAS number, including other names
(2R,3S)-N-Cbz-6-oxo-2,3-diphenylmorpholine 95% (CAS 100516-54-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A549970-250mg |
| cas | 100516-54-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 765.31 Pln | |
| Ambeed | 25g | 2350.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A549970 |
Benzyl (2R,3S)-6-oxo-2,3-diphenylmorpholine-4-carboxylate (CAS 100516-54-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: benzyl (2R,3S)-6-oxo-2,3-diphenylmorpholine-4-carboxylate. InChIKey: HECRUWTZAMPQOS-XZOQPEGZSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | benzyl (2R,3S)-6-oxo-2,3-diphenylmorpholine-4-carboxylate |
| InChIKey | HECRUWTZAMPQOS-XZOQPEGZSA-N |
| SMILES | C1C(=O)O[C@@H]([C@@H](N1C(=O)OCC2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)