cas: 69651-48-5 — see every product listed under this CAS number, including other names
(2S)-[(TERT-BUTOXYCARBONYL)AMINO](4-HYDROXYPHENYL)ETHANOIC ACID, 96% (CAS 69651-48-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468855-1G |
| cas | 69651-48-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 378.01 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1309.97 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 69651-48-5) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: (2S)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: LRWJRIFKJPPAPM-JTQLQIEISA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | (2S)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | LRWJRIFKJPPAPM-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)