cas: 762233-34-1 — see every product listed under this CAS number, including other names
(2S,4R)-1-Benzyl 2-methyl 4-aminopyrrolidine-1,2-dicarboxylate, 98+% (CAS 762233-34-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A508623-10g |
| cas | 762233-34-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 9691.78 Pln | |
| AmBeed | 100mg | 629.86 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate (CAS 762233-34-1) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate. InChIKey: DMYAHNRIJNKMAH-NEPJUHHUSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate |
| InChIKey | DMYAHNRIJNKMAH-NEPJUHHUSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)