cas: 762233-34-1 — see every product listed under this CAS number, including other names
1-Benzyl 2-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate, 97%, 97% (CAS 762233-34-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G8DS-100mg |
| cas | 762233-34-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 500mg | 851.60 Pln | |
| Chemat | 1g | 1250.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate (CAS 762233-34-1) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate. InChIKey: DMYAHNRIJNKMAH-NEPJUHHUSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate |
| InChIKey | DMYAHNRIJNKMAH-NEPJUHHUSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)