cas: 409325-33-3 — see every product listed under this CAS number, including other names
(2S,4R)-4-Amino-1-cbz-pyrrolidine-2-carboxylic acid methyl ester-hcl, 95%, 95% (CAS 409325-33-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 25mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1184XO-50mg |
| cas | 409325-33-3 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 338.00 Pln | |
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 250mg | 904.40 Pln | |
| Chemat | 25mg | 222.80 Pln | |
| Chemat | 1g | 2344.40 Pln | |
| Chemat | 5g | 9184.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride (CAS 409325-33-3) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride. InChIKey: VLLRSJJKBDFSMT-LYCTWNKOSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | VLLRSJJKBDFSMT-LYCTWNKOSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)