cas: 409325-33-3 — see every product listed under this CAS number, including other names
Cbz-4-NH2-Pro-OMe HCl 95% (CAS 409325-33-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 25mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A772502-50mg |
| cas | 409325-33-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 392.62 Pln | |
| Ambeed | 100mg | 553.94 Pln | |
| Ambeed | 250mg | 759.75 Pln | |
| Ambeed | 1g | 2662.12 Pln | |
| Ambeed | 5g | 10438.50 Pln | |
| Ambeed | 25mg | 337.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A772502 |
1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride (CAS 409325-33-3) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride. InChIKey: VLLRSJJKBDFSMT-LYCTWNKOSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | VLLRSJJKBDFSMT-LYCTWNKOSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)