cas: 409325-33-3 — see every product listed under this CAS number, including other names
Methyl (2S,4R)-4-amino-1-Cbz-pyrrolidine-2-carboxylate hydrochloride, 97% (CAS 409325-33-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213294-250MG |
| cas | 409325-33-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1403.69 Pln | |
| Fluorochem | 1g | 4038.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride (CAS 409325-33-3) is a chemical compound with the molecular formula C14H19ClN2O4 and a molecular weight of 314.76 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride. InChIKey: VLLRSJJKBDFSMT-LYCTWNKOSA-N.
| Molecular formula | C14H19ClN2O4 |
|---|---|
| Molecular weight | 314.76 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | VLLRSJJKBDFSMT-LYCTWNKOSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)