cas: 1160561-29-4 — see every product listed under this CAS number, including other names
(3,4-Dichloro-2-fluorophenyl)boronic acid, ≥95%, ≥95% (CAS 1160561-29-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BIG3-100mg |
| cas | 1160561-29-4 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2411.60 Pln | |
| Chemat | 250mg | 3414.80 Pln | |
| Chemat | 1g | 6755.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(3,4-dichloro-2-fluorophenyl)boronic acid (CAS 1160561-29-4) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (3,4-dichloro-2-fluorophenyl)boronic acid. InChIKey: VAGMFOMFJZBNKB-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (3,4-dichloro-2-fluorophenyl)boronic acid |
| InChIKey | VAGMFOMFJZBNKB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)Cl)F)(O)O |
Computed by PubChem (NCBI)