cas: 1160561-29-4 — see every product listed under this CAS number, including other names
(3,4-Dichloro-2-fluorophenyl)boronic acid, 98% (CAS 1160561-29-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A715725-5g |
| cas | 1160561-29-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 51440.41 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,4-dichloro-2-fluorophenyl)boronic acid (CAS 1160561-29-4) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (3,4-dichloro-2-fluorophenyl)boronic acid. InChIKey: VAGMFOMFJZBNKB-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (3,4-dichloro-2-fluorophenyl)boronic acid |
| InChIKey | VAGMFOMFJZBNKB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)Cl)F)(O)O |
Computed by PubChem (NCBI)