cas: 1772622-45-3 — see every product listed under this CAS number, including other names
(3,4-Dichloro-5-methylphenyl)boronic acid, 97% (CAS 1772622-45-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A678241-5g |
| cas | 1772622-45-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 13187.65 Pln | |
| AmBeed | 10g | 22327.69 Pln | |
| AmBeed | 25g | 43823.71 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,4-dichloro-5-methylphenyl)boronic acid (CAS 1772622-45-3) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (3,4-dichloro-5-methylphenyl)boronic acid. InChIKey: BGCJOTQVISYGAZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (3,4-dichloro-5-methylphenyl)boronic acid |
| InChIKey | BGCJOTQVISYGAZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)Cl)C)(O)O |
Computed by PubChem (NCBI)