(3-(Methoxycarbonyl)-4-methylphenyl)boronic acid, 97%
cas: 1048330-10-4 — see every product listed under this CAS number, including other names
(3-(Methoxycarbonyl)-4-methylphenyl)boronic acid, 97% (CAS 1048330-10-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch118XC6-100mg |
| cas | 1048330-10-4 |
| size | 100mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1235.60 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 1208.49 Pln | |
| BLDpharm | 25g | 4179.66 Pln | |
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 336.36 Pln | |
| Fluorochem | 5g | 1164.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-methoxycarbonyl-4-methylphenyl)boronic acid (CAS 1048330-10-4) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: (3-methoxycarbonyl-4-methylphenyl)boronic acid. InChIKey: CDWTTYCJDYKRNE-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | (3-methoxycarbonyl-4-methylphenyl)boronic acid |
| InChIKey | CDWTTYCJDYKRNE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)C(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-(Methoxycarbonyl)-4-methylphenyl)boronic acid, [3-(methoxycarbonyl)-4-methylphenyl]boronic acid, (3-methoxycarbonyl-4-methylphenyl)boronic acid, 5-Borono-2-methylbenzoic acid 1-methyl ester, (3-methoxycarbonyl-4-methyl-phenyl)boronic acid, 3-(Methoxycarbonyl)-4-3-(Methoxycarbonyl)-4-methylphenylboronic Acid