Products 1048330-10-4
CAS 1048330-10-4 appears in our catalog under these names: (3–(Methoxycarbonyl)–4–methylphenyl)boronic acid, 3-(Methoxycarbonyl)-4-methylphenylboronic acid, 97%, (3-(Methoxycarbonyl)-4-methylphenyl)boronic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg.
(3-methoxycarbonyl-4-methylphenyl)boronic acid (CAS 1048330-10-4) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: (3-methoxycarbonyl-4-methylphenyl)boronic acid. InChIKey: CDWTTYCJDYKRNE-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | (3-methoxycarbonyl-4-methylphenyl)boronic acid |
| InChIKey | CDWTTYCJDYKRNE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)C(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-(Methoxycarbonyl)-4-methylphenyl)boronic acid, [3-(methoxycarbonyl)-4-methylphenyl]boronic acid, (3-methoxycarbonyl-4-methylphenyl)boronic acid, 5-Borono-2-methylbenzoic acid 1-methyl ester, (3-methoxycarbonyl-4-methyl-phenyl)boronic acid, 3-(Methoxycarbonyl)-4-3-(Methoxycarbonyl)-4-methylphenylboronic Acid