(3-Bromo-2,4-difluorophenyl)boronic acid, 98%
cas: 2377609-38-4 — see every product listed under this CAS number, including other names
(3-Bromo-2,4-difluorophenyl)boronic acid, 98% (CAS 2377609-38-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A968363-5g |
| cas | 2377609-38-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6241.48 Pln | |
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 466.52 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 4475.53 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-bromo-2,4-difluorophenyl)boronic acid (CAS 2377609-38-4) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (3-bromo-2,4-difluorophenyl)boronic acid. InChIKey: GXYAIRRGHDIHNV-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (3-bromo-2,4-difluorophenyl)boronic acid |
| InChIKey | GXYAIRRGHDIHNV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)Br)F)(O)O |
Computed by PubChem (NCBI)