(3-Bromo-2，4-Difluorophenyl)Boronic Acid, 98%, 98%
cas: 2377609-38-4 — see every product listed under this CAS number, including other names
(3-Bromo-2，4-Difluorophenyl)Boronic Acid, 98%, 98% (CAS 2377609-38-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JN3S-100mg |
| cas | 2377609-38-4 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1283.60 Pln | |
| Chemat | 5g | 3731.60 Pln | |
| Chemat | 500mg | 1082.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-bromo-2,4-difluorophenyl)boronic acid (CAS 2377609-38-4) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (3-bromo-2,4-difluorophenyl)boronic acid. InChIKey: GXYAIRRGHDIHNV-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (3-bromo-2,4-difluorophenyl)boronic acid |
| InChIKey | GXYAIRRGHDIHNV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)Br)F)(O)O |
Computed by PubChem (NCBI)