cas: 870777-26-7 — see every product listed under this CAS number, including other names
(3-Chloro-4-((2-chlorobenzyl)oxy)phenyl)boronic acid 95% (CAS 870777-26-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A258678-250mg |
| cas | 870777-26-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1816.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A258678 |
[3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]boronic acid (CAS 870777-26-7) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: [3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]boronic acid. InChIKey: LWCZZSFOCSCENS-UHFFFAOYSA-N.
| Molecular formula | C13H11BCl2O3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | [3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | LWCZZSFOCSCENS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=CC=C2Cl)Cl)(O)O |
Computed by PubChem (NCBI)