CAS 1003298-85-8 appears in our catalog under these names: 4-(Benzyloxy)-3,5-dichlorophenylboronic acid, 98%, (4-(Benzyloxy)-3,5-dichlorophenyl)boronic acid, 98%, 4-Benzyloxy-3,5-dichlorophenylboronic acid, 95%, 95%, (4-(Benzyloxy)-3,5-dichlorophenyl)boronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
(3,5-dichloro-4-phenylmethoxyphenyl)boronic acid (CAS 1003298-85-8) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: (3,5-dichloro-4-phenylmethoxyphenyl)boronic acid. InChIKey: BAXPPGSWZDNMOG-UHFFFAOYSA-N.
| Molecular formula | C13H11BCl2O3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | (3,5-dichloro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | BAXPPGSWZDNMOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OCC2=CC=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)