CAS 1256346-47-0 appears in our catalog under these names: 5-(Benzyloxy)-2,4-dichlorophenylboronic acid, 95%, 5-(Benzyloxy)-2,4-dichlorophenylboronic acid, 98%, 98%, (5-(Benzyloxy)-2,4-dichlorophenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2,4-dichloro-5-phenylmethoxyphenyl)boronic acid (CAS 1256346-47-0) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: (2,4-dichloro-5-phenylmethoxyphenyl)boronic acid. InChIKey: WKVMHOHDMRUZMC-UHFFFAOYSA-N.
| Molecular formula | C13H11BCl2O3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | (2,4-dichloro-5-phenylmethoxyphenyl)boronic acid |
| InChIKey | WKVMHOHDMRUZMC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)