CAS 870777-26-7 appears in our catalog under these names: 3-Chloro-4-(2'-chlorobenzyloxy)phenylboronic acid, 95%, (3-Chloro-4-((2-chlorobenzyl)oxy)phenyl)boronic acid, 95%, 95%, (3-Chloro-4-((2-chlorobenzyl)oxy)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
[3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]boronic acid (CAS 870777-26-7) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: [3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]boronic acid. InChIKey: LWCZZSFOCSCENS-UHFFFAOYSA-N.
| Molecular formula | C13H11BCl2O3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | [3-chloro-4-[(2-chlorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | LWCZZSFOCSCENS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=CC=C2Cl)Cl)(O)O |
Computed by PubChem (NCBI)