Products 1256355-71-1

CAS 1256355-71-1 is the registry number for 4-(2,6-Dichlorophenylmethoxy)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

[4-[(2,6-dichlorophenyl)methoxy]phenyl]boronic acid (CAS 1256355-71-1) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: [4-[(2,6-dichlorophenyl)methoxy]phenyl]boronic acid. InChIKey: LNWNXHQLHDTDAW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BCl2O3
Molecular weight296.9 g/mol
IUPAC name[4-[(2,6-dichlorophenyl)methoxy]phenyl]boronic acid
InChIKeyLNWNXHQLHDTDAW-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)OCC2=C(C=CC=C2Cl)Cl)(O)O

Computed by PubChem (NCBI)