Products 1072946-32-7
CAS 1072946-32-7 appears in our catalog under these names: 3-(Benzyloxy)-2,4-dichlorophenylboronic acid, 98%, (3-(Benzyloxy)-2,4-dichlorophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(2,4-dichloro-3-phenylmethoxyphenyl)boronic acid (CAS 1072946-32-7) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: (2,4-dichloro-3-phenylmethoxyphenyl)boronic acid. InChIKey: ISXBLZCSJKQVQQ-UHFFFAOYSA-N.
| Molecular formula | C13H11BCl2O3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | (2,4-dichloro-3-phenylmethoxyphenyl)boronic acid |
| InChIKey | ISXBLZCSJKQVQQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)OCC2=CC=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)