CAS 1256355-75-5 appears in our catalog under these names: 4-(2,4-Dichlorophenylmethoxy)phenylboronic acid, 97%, (4-((2,4-Dichlorobenzyl)oxy)phenyl)boronic acid, 98%, (4-((2,4-Dichlorobenzyl)oxy)phenyl)boronic acid, 95%, 95%, (4-((2,4-Dichlorobenzyl)oxy)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[4-[(2,4-dichlorophenyl)methoxy]phenyl]boronic acid (CAS 1256355-75-5) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: [4-[(2,4-dichlorophenyl)methoxy]phenyl]boronic acid. InChIKey: OCZXYAVYBZVAJM-UHFFFAOYSA-N.
| Molecular formula | C13H11BCl2O3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | [4-[(2,4-dichlorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | OCZXYAVYBZVAJM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=C(C=C(C=C2)Cl)Cl)(O)O |
Computed by PubChem (NCBI)