Products 1256355-85-7
CAS 1256355-85-7 appears in our catalog under these names: 2-(2,6-Dichlorophenylmethoxy)phenylboronic acid, 96%, (2-((2,6-Dichlorobenzyl)oxy)phenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[2-[(2,6-dichlorophenyl)methoxy]phenyl]boronic acid (CAS 1256355-85-7) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: [2-[(2,6-dichlorophenyl)methoxy]phenyl]boronic acid. InChIKey: GMDQQBXOTWOKNM-UHFFFAOYSA-N.
| Molecular formula | C13H11BCl2O3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | [2-[(2,6-dichlorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | GMDQQBXOTWOKNM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC2=C(C=CC=C2Cl)Cl)(O)O |
Computed by PubChem (NCBI)