cas: 957120-59-1 — see every product listed under this CAS number, including other names
(3-Chloro-5-(diethylcarbamoyl)phenyl)boronic acid 98% (CAS 957120-59-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A981983-100mg |
| cas | 957120-59-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A981983 |
[3-chloro-5-(diethylcarbamoyl)phenyl]boronic acid (CAS 957120-59-1) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [3-chloro-5-(diethylcarbamoyl)phenyl]boronic acid. InChIKey: KVYOLHXPKSCLCF-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [3-chloro-5-(diethylcarbamoyl)phenyl]boronic acid |
| InChIKey | KVYOLHXPKSCLCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)C(=O)N(CC)CC)(O)O |
Computed by PubChem (NCBI)