CAS 1451393-01-3 appears in our catalog under these names: 3-Chloro-2-(morpholinomethyl)phenylboronic acid, 3-Chloro-2-(morpholinomethyl)phenylboronic acid, 95%, (3-Chloro-2-(morpholinomethyl)phenyl)boronic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg.
[3-chloro-2-(morpholin-4-ylmethyl)phenyl]boronic acid (CAS 1451393-01-3) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [3-chloro-2-(morpholin-4-ylmethyl)phenyl]boronic acid. InChIKey: NVCYJWADWXOQCF-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [3-chloro-2-(morpholin-4-ylmethyl)phenyl]boronic acid |
| InChIKey | NVCYJWADWXOQCF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)CN2CCOCC2)(O)O |
Computed by PubChem (NCBI)