CAS 185950-64-5 appears in our catalog under these names: 5-Chloro-2-(pivaloylamino)phenylboronic acid, 5-Chloro-2-(pivaloylamino)phenylboronic acid, 95%, (5-Chloro-2-pivalamidophenyl)boronic acid, 95+%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
[5-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid (CAS 185950-64-5) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [5-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid. InChIKey: GIAJZMJDKJWGNY-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [5-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
| InChIKey | GIAJZMJDKJWGNY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)