CAS 871332-94-4 appears in our catalog under these names: (3-(Butylcarbamoyl)-4-chlorophenyl)boronic acid, 98%, 4-Chloro-3-(n-butylaminocarbonyl)phenylboronic acid, 98%. Offered by: Ambeed, Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 25g.
[3-(butylcarbamoyl)-4-chlorophenyl]boronic acid (CAS 871332-94-4) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [3-(butylcarbamoyl)-4-chlorophenyl]boronic acid. InChIKey: PAXNXDXMDDBNJD-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [3-(butylcarbamoyl)-4-chlorophenyl]boronic acid |
| InChIKey | PAXNXDXMDDBNJD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)NCCCC)(O)O |
Computed by PubChem (NCBI)