CAS 957120-59-1 appears in our catalog under these names: N-Diethyl 3-borono-5-chlorobenzamide, 98%, 3-Chloro-5-(diethylcarbonyl)phenylboronic acid, 98%, 98%, (3-Chloro-5-(diethylcarbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
[3-chloro-5-(diethylcarbamoyl)phenyl]boronic acid (CAS 957120-59-1) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [3-chloro-5-(diethylcarbamoyl)phenyl]boronic acid. InChIKey: KVYOLHXPKSCLCF-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [3-chloro-5-(diethylcarbamoyl)phenyl]boronic acid |
| InChIKey | KVYOLHXPKSCLCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)C(=O)N(CC)CC)(O)O |
Computed by PubChem (NCBI)