Products 871332-68-2
CAS 871332-68-2 appears in our catalog under these names: 4-Chloro-3-(N,N-diethylcarbamoyl)phenylboronic acid, 98%, (4-Chloro-3-(diethylcarbamoyl)phenyl)boronic acid, 95%, 95%, (4-Chloro-3-(diethylcarbamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
[4-chloro-3-(diethylcarbamoyl)phenyl]boronic acid (CAS 871332-68-2) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [4-chloro-3-(diethylcarbamoyl)phenyl]boronic acid. InChIKey: JLDCVUGASMQNGS-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [4-chloro-3-(diethylcarbamoyl)phenyl]boronic acid |
| InChIKey | JLDCVUGASMQNGS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)N(CC)CC)(O)O |
Computed by PubChem (NCBI)