CAS 1451390-83-2 appears in our catalog under these names: 2-(tert-Butylcarbonylamino)-6-chlorophenylboronic acid, 2-(tert-Butylcarbonylamino)-6-chlorophenylboronic acid, 95%, (2-Chloro-6-pivalamidophenyl)boronic acid, 98+%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g, 25g.
[2-chloro-6-(2,2-dimethylpropanoylamino)phenyl]boronic acid (CAS 1451390-83-2) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [2-chloro-6-(2,2-dimethylpropanoylamino)phenyl]boronic acid. InChIKey: SPNIKRUJDDBTIY-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [2-chloro-6-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
| InChIKey | SPNIKRUJDDBTIY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1Cl)NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)