Products 850589-48-9
CAS 850589-48-9 is the registry number for 3-Chloro-4-(N,N-diethylcarbamoyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 100g, 1g.
[3-chloro-4-(diethylcarbamoyl)phenyl]boronic acid (CAS 850589-48-9) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [3-chloro-4-(diethylcarbamoyl)phenyl]boronic acid. InChIKey: CRFVBNBIELTWGR-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [3-chloro-4-(diethylcarbamoyl)phenyl]boronic acid |
| InChIKey | CRFVBNBIELTWGR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)N(CC)CC)Cl)(O)O |
Computed by PubChem (NCBI)