cas: 2121513-76-4 — see every product listed under this CAS number, including other names
(3-Chloro-5-fluoro-2-methoxyphenyl)boronic acid 97% (CAS 2121513-76-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A624337-250mg |
| cas | 2121513-76-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 615.13 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A624337 |
(3-chloro-5-fluoro-2-methoxyphenyl)boronic acid (CAS 2121513-76-4) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (3-chloro-5-fluoro-2-methoxyphenyl)boronic acid. InChIKey: FJDLPAVBXZISKS-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (3-chloro-5-fluoro-2-methoxyphenyl)boronic acid |
| InChIKey | FJDLPAVBXZISKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)Cl)F)(O)O |
Computed by PubChem (NCBI)