cas: 2121513-76-4 — see every product listed under this CAS number, including other names
3-Chloro-5-fluoro-2-methoxyphenylboronic acid, 98%, 98% (CAS 2121513-76-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHNR-100mg |
| cas | 2121513-76-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 482.00 Pln | |
| Chemat | 25g | 2171.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-chloro-5-fluoro-2-methoxyphenyl)boronic acid (CAS 2121513-76-4) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (3-chloro-5-fluoro-2-methoxyphenyl)boronic acid. InChIKey: FJDLPAVBXZISKS-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (3-chloro-5-fluoro-2-methoxyphenyl)boronic acid |
| InChIKey | FJDLPAVBXZISKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)Cl)F)(O)O |
Computed by PubChem (NCBI)