(3-Fluoro-2,4-dimethoxyphenyl)boronic acid, 98%, 98%
cas: 949146-39-8 — see every product listed under this CAS number, including other names
(3-Fluoro-2,4-dimethoxyphenyl)boronic acid, 98%, 98% (CAS 949146-39-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IINF-5g |
| cas | 949146-39-8 |
| size | 5g |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 640.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 208.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-fluoro-2,4-dimethoxyphenyl)boronic acid (CAS 949146-39-8) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (3-fluoro-2,4-dimethoxyphenyl)boronic acid. InChIKey: BISXERIORTWMKJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (3-fluoro-2,4-dimethoxyphenyl)boronic acid |
| InChIKey | BISXERIORTWMKJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)F)OC)(O)O |
Computed by PubChem (NCBI)