cas: 201864-71-3 — see every product listed under this CAS number, including other names
(3R)-3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]butanoic acid, 97% (CAS 201864-71-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F613729-1G |
| cas | 201864-71-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 466.52 Pln | |
| Fluorochem | 25g | 1044.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 201864-71-3) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LYMLSPRRJWJJQD-GFCCVEGCSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LYMLSPRRJWJJQD-GFCCVEGCSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)