CAS 193954-26-6 appears in our catalog under these names: Fmoc–?–HoAla–OH, Fmoc-L-beta-HAla-OH, Fmoc-β-HoAla-OH 97%, (S)-3-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]butanoic acid, 97%, 97%, fmoc-b-Homoalanine, 96%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 100g, 10g.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 193954-26-6) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LYMLSPRRJWJJQD-LBPRGKRZSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LYMLSPRRJWJJQD-LBPRGKRZSA-N |
| SMILES | C[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)