cas: 1072951-79-1 — see every product listed under this CAS number, including other names
(4'-(Pentan-2-yloxy)-[1,1'-biphenyl]-4-yl)boronic acid, 98% (CAS 1072951-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691545-1G |
| cas | 1072951-79-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 747.67 Pln | |
| Fluorochem | 5g | 2481.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-(4-pentan-2-yloxyphenyl)phenyl]boronic acid (CAS 1072951-79-1) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: [4-(4-pentan-2-yloxyphenyl)phenyl]boronic acid. InChIKey: GHVDSTWRPUFXCV-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | [4-(4-pentan-2-yloxyphenyl)phenyl]boronic acid |
| InChIKey | GHVDSTWRPUFXCV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OC(C)CCC)(O)O |
Computed by PubChem (NCBI)