cas: 1072951-79-1 — see every product listed under this CAS number, including other names
4-(4'-(2-Pentyloxy)phenyl)phenylboronic acid, ≥98%, ≥98% (CAS 1072951-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K2K-1g |
| cas | 1072951-79-1 |
| size | 1g |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1514.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
[4-(4-pentan-2-yloxyphenyl)phenyl]boronic acid (CAS 1072951-79-1) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: [4-(4-pentan-2-yloxyphenyl)phenyl]boronic acid. InChIKey: GHVDSTWRPUFXCV-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | [4-(4-pentan-2-yloxyphenyl)phenyl]boronic acid |
| InChIKey | GHVDSTWRPUFXCV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OC(C)CCC)(O)O |
Computed by PubChem (NCBI)