cas: 849062-20-0 — see every product listed under this CAS number, including other names
(4'-Propoxy-[1,1'-biphenyl]-4-yl)boronic acid 98% (CAS 849062-20-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A563198-250mg |
| cas | 849062-20-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A563198 |
[4-(4-propoxyphenyl)phenyl]boronic acid (CAS 849062-20-0) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: [4-(4-propoxyphenyl)phenyl]boronic acid. InChIKey: ZJCHLFOLMBDUPR-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | [4-(4-propoxyphenyl)phenyl]boronic acid |
| InChIKey | ZJCHLFOLMBDUPR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCCC)(O)O |
Computed by PubChem (NCBI)