cas: 849062-20-0 — see every product listed under this CAS number, including other names
4-(4'-Propoxyphenyl)phenylboronic acid, 98%, 98% (CAS 849062-20-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BWO-250mg |
| cas | 849062-20-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 462.80 Pln | |
| Chemat | 5g | 1682.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(4-propoxyphenyl)phenyl]boronic acid (CAS 849062-20-0) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: [4-(4-propoxyphenyl)phenyl]boronic acid. InChIKey: ZJCHLFOLMBDUPR-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | [4-(4-propoxyphenyl)phenyl]boronic acid |
| InChIKey | ZJCHLFOLMBDUPR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCCC)(O)O |
Computed by PubChem (NCBI)