cas: 849062-20-0 — see every product listed under this CAS number, including other names
4'–n–Propoxybiphenyl–4–boronic acid (contains varying amounts of Anhydride) (CAS 849062-20-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD20271-1g |
| cas | 849062-20-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 877.87 Pln | |
| GLPBio | 250mg | 629.80 Pln | |
| GLPBio | 5g | 2319.46 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(4-propoxyphenyl)phenyl]boronic acid (CAS 849062-20-0) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: [4-(4-propoxyphenyl)phenyl]boronic acid. InChIKey: ZJCHLFOLMBDUPR-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | [4-(4-propoxyphenyl)phenyl]boronic acid |
| InChIKey | ZJCHLFOLMBDUPR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCCC)(O)O |
Computed by PubChem (NCBI)