cas: 515140-26-8 — see every product listed under this CAS number, including other names
(4-((Cyclopropylmethyl)carbamoyl)phenyl)boronic acid, 98% (CAS 515140-26-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F623892-250MG |
| cas | 515140-26-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 747.67 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-(cyclopropylcarbamoyl)phenyl]boronic acid (CAS 515140-26-8) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: [4-(cyclopropylcarbamoyl)phenyl]boronic acid. InChIKey: WCRPDYXXIVYAAJ-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | [4-(cyclopropylcarbamoyl)phenyl]boronic acid |
| InChIKey | WCRPDYXXIVYAAJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2CC2)(O)O |
Computed by PubChem (NCBI)