CAS 860173-33-7 appears in our catalog under these names: 4–(Cyclopropylcarbamoyl)phenylboronic Acid, (4-(Cyclopropylcarbamoyl)phenyl)boronic acid 97%, Boronic acid, B-[4-[(cyclopropylamino)carbonyl]phenyl]-, 97%, 97%, (4-(Cyclopropylcarbamoyl)phenyl)boronic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
[4-(cyclopropylcarbamoyl)phenyl]boronic acid (CAS 860173-33-7) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: [4-(cyclopropylcarbamoyl)phenyl]boronic acid. InChIKey: WCRPDYXXIVYAAJ-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | [4-(cyclopropylcarbamoyl)phenyl]boronic acid |
| InChIKey | WCRPDYXXIVYAAJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2CC2)(O)O |
Computed by PubChem (NCBI)